CymitQuimica logo

CAS 88780-19-2

:

Benzenamine, 4,4'-methylenebis[3-chloro-N,N-dipropyl-

Description:
Benzenamine, 4,4'-methylenebis[3-chloro-N,N-dipropyl-] is an organic compound characterized by its structure, which includes a benzene ring substituted with a methylene bridge and two dipropylamino groups, each further substituted with chlorine atoms. This compound is part of the class of amines and is known for its potential applications in various chemical processes, including as an intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. The presence of chlorine atoms enhances its reactivity and may influence its solubility and stability in different solvents. Additionally, the dipropyl groups contribute to its hydrophobic characteristics, affecting its behavior in biological systems and environmental interactions. Safety data indicates that, like many chlorinated amines, it may pose risks regarding toxicity and environmental impact, necessitating careful handling and disposal. Overall, this compound exemplifies the complexity of organic chemistry, showcasing the interplay between structure and function in chemical substances.
Formula:C25H36Cl2N2
InChI:InChI=1S/C25H36Cl2N2/c1-5-13-28(14-6-2)22-11-9-20(24(26)18-22)17-21-10-12-23(19-25(21)27)29(15-7-3)16-8-4/h9-12,18-19H,5-8,13-17H2,1-4H3
InChI key:KBTLWTBJWGEUPY-UHFFFAOYSA-N
SMILES:CCCN(CCC)C1=CC(=C(C=C1)CC2=C(C=C(C=C2)N(CCC)CCC)Cl)Cl
Synonyms:
  • Benzenamine, 4,4'-methylenebis[3-chloro-N,N-dipropyl-
Found 1 products.