CAS 88780-61-4
:Formamide, N-methyl-N-[2-(2-pyridinyl)ethyl]-
Description:
Formamide, N-methyl-N-[2-(2-pyridinyl)ethyl]- is an organic compound characterized by its amide functional group, which is derived from formic acid. This substance features a methyl group and a 2-(2-pyridinyl)ethyl substituent, contributing to its unique properties. It is typically a colorless to pale yellow liquid with a moderate boiling point and is soluble in water and various organic solvents, reflecting its polar nature. The presence of the pyridine ring imparts basicity and potential for coordination with metal ions, making it useful in various chemical applications, including as a solvent or reagent in organic synthesis. Additionally, the compound may exhibit biological activity, which could be relevant in pharmaceutical contexts. Safety data should be consulted, as it may pose health risks upon exposure. Overall, its structural characteristics and functional groups make it a compound of interest in both industrial and research settings.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c1-11(8-12)7-5-9-4-2-3-6-10-9/h2-4,6,8H,5,7H2,1H3
InChI key:ZZIDIVKNCWYPIG-UHFFFAOYSA-N
SMILES:CN(CCC1=CC=CC=N1)C=O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
N-Methyl-N-(2-(pyridin-2-yl)ethyl)formamide
CAS:Controlled ProductFormula:C9H12N2OColor and Shape:NeatMolecular weight:164.204



