CymitQuimica logo

CAS 88783-75-9

:

Propanedinitrile, [1-(4-nitrophenyl)-3-oxo-3-phenylpropyl]-

Description:
Propanedinitrile, [1-(4-nitrophenyl)-3-oxo-3-phenylpropyl]- is an organic compound characterized by its complex structure, which includes a propanedinitrile backbone with a phenyl group and a nitrophenyl substituent. This compound typically exhibits properties associated with nitriles, such as being polar and having a relatively high boiling point due to the presence of multiple functional groups. The nitrophenyl moiety can impart additional reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The presence of the carbonyl group (ketone) in the structure contributes to its potential as a reactive intermediate in organic synthesis. Additionally, the compound may exhibit specific optical properties due to the arrangement of its substituents, which can influence its behavior in light absorption and emission. Overall, this compound's unique combination of functional groups makes it of interest in fields such as medicinal chemistry and materials science, where it may serve as a precursor or building block for more complex molecules.
Formula:C18H13N3O3
InChI:InChI=1S/C18H13N3O3/c19-11-15(12-20)17(10-18(22)14-4-2-1-3-5-14)13-6-8-16(9-7-13)21(23)24/h1-9,15,17H,10H2
InChI key:VQBZNGYQYYXIDW-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C(=O)CC(C2=CC=C(C=C2)[N+](=O)[O-])C(C#N)C#N
Found 1 products.