CAS 88785-32-4
:7-Hexadecenoic acid, 16-hydroxy-, (E)-
Description:
7-Hexadecenoic acid, 16-hydroxy-, (E)-, also known by its CAS number 88785-32-4, is a fatty acid characterized by a long hydrocarbon chain with a double bond and a hydroxyl group. This compound features a 16-carbon backbone with a cis double bond located at the seventh carbon from the carboxylic acid end, which contributes to its unsaturated nature. The presence of the hydroxyl group at the 16th carbon enhances its reactivity and solubility in polar solvents compared to saturated fatty acids. This compound is typically found in various natural sources, including certain plant oils and animal fats, and may play a role in biological processes such as signaling and membrane fluidity. Its unique structure allows it to participate in various chemical reactions, making it of interest in both industrial applications and biochemical research. Additionally, the (E)-configuration indicates the specific geometric arrangement of the double bond, which can influence the compound's physical and chemical properties.
Formula:C16H30O3
InChI:InChI=1S/C16H30O3/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h2,4,17H,1,3,5-15H2,(H,18,19)/b4-2+
InChI key:MKIFOPBVDBXRTO-DUXPYHPUSA-N
SMILES:C(CCCCO)CCC/C=C/CCCCCC(=O)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
