CAS 88791-07-5
:7-methoxy-1-benzothiophene-2-carboxylic acid
Description:
7-Methoxy-1-benzothiophene-2-carboxylic acid is a chemical compound characterized by its unique structure, which includes a benzothiophene core with a methoxy group and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carboxylic acid group. The methoxy group can influence its solubility and polarity, making it more soluble in organic solvents. The presence of the thiophene ring contributes to its electronic properties, potentially allowing for interactions in various chemical reactions, including electrophilic substitutions. This compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its specific applications and reactivity can vary based on the context of use, including potential roles in organic synthesis or as a precursor in the development of more complex molecules. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H8O3S
InChI:InChI=1/C10H8O3S/c1-13-7-4-2-3-6-5-8(10(11)12)14-9(6)7/h2-5H,1H3,(H,11,12)
SMILES:COc1cccc2cc(C(=O)O)sc12
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-Methoxybenzo[b]thiophene-2-carboxylic acid
CAS:7-Methoxybenzo[b]thiophene-2-carboxylic acidFormula:C10H8O3SPurity:≥95%Color and Shape:SolidMolecular weight:208.233727-Methoxybenzo[b]thiophene-2-carboxylic acid
CAS:Formula:C10H8O3SPurity:97%Color and Shape:SolidMolecular weight:208.23377-Methoxybenzo[b]thiophene-2-carboxylic acid
CAS:7-Methoxybenzo[b]thiophene-2-carboxylic acid is a condensation product that can be formed by reacting chloramine with 2-hydroxy-3-methoxybenzaldehyde. This compound can also be produced by demethylation of 7-methoxybenzo[b]thiophene, decarboxylation of 7-methoxybenzo[b]thiophene, and nitration of 7-methoxybenzo[b]thiophene. The reaction of this compound with thiols produces the corresponding 3,4,5,6-tetrahydrobenzothiazoles. Bromination followed by hydrolysis produces benzo[b]thiophenesulfonic acid and bromine.
Formula:C10H8O3SPurity:Min. 95%Molecular weight:208.23 g/mol




