CymitQuimica logo

CAS 88794-55-2

:

Methanone, [2-hydroxy-4-(3-hydroxypropoxy)phenyl]phenyl-

Description:
Methanone, [2-hydroxy-4-(3-hydroxypropoxy)phenyl]phenyl- (CAS 88794-55-2) is an organic compound characterized by its complex structure, which includes a phenyl group and hydroxypropoxy substituents. This compound features a ketone functional group (methanone) and multiple hydroxyl groups, contributing to its potential as a versatile chemical in various applications. The presence of hydroxyl groups enhances its solubility in polar solvents and may impart hydrogen-bonding capabilities, influencing its reactivity and interactions with other molecules. The compound's phenolic structure suggests potential antioxidant properties, making it of interest in fields such as pharmaceuticals and materials science. Additionally, the specific arrangement of substituents can affect its electronic properties, stability, and biological activity. Overall, Methanone, [2-hydroxy-4-(3-hydroxypropoxy)phenyl]phenyl- is a compound with unique characteristics that may be explored for various industrial and research applications.
Formula:C16H16O4
InChI:InChI=1S/C16H16O4/c17-9-4-10-20-13-7-8-14(15(18)11-13)16(19)12-5-2-1-3-6-12/h1-3,5-8,11,17-18H,4,9-10H2
InChI key:AGYGLKOVASZVOQ-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C(=O)C2=C(C=C(C=C2)OCCCO)O
Found 1 products.