CAS 88795-34-0
:1-Propanesulfonic acid, 3-[ethyl(3-methoxyphenyl)amino]-
Description:
1-Propanesulfonic acid, 3-[ethyl(3-methoxyphenyl)amino]- is an organic compound characterized by its sulfonic acid functional group, which imparts strong acidity and solubility in water. The presence of the ethyl(3-methoxyphenyl)amino group suggests that it has both hydrophobic and hydrophilic characteristics, making it potentially useful in various applications, including pharmaceuticals and as a surfactant. The compound's structure indicates that it may participate in hydrogen bonding due to the sulfonic acid group, enhancing its reactivity and interaction with biological systems. Additionally, the methoxy group can influence the compound's electronic properties and steric hindrance, affecting its biological activity and solubility. Overall, this compound's unique combination of functional groups suggests potential utility in medicinal chemistry and as a biochemical probe, although specific applications would depend on further research into its properties and behavior in different environments.
Formula:C12H19NO4S
InChI:InChI=1S/C12H19NO4S/c1-3-13(8-5-9-18(14,15)16)11-6-4-7-12(10-11)17-2/h4,6-7,10H,3,5,8-9H2,1-2H3,(H,14,15,16)
InChI key:STBWJPWQQLXSCK-UHFFFAOYSA-N
SMILES:CCN(CCCS(=O)(=O)O)C1=CC(=CC=C1)OC
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-Propanesulfonic acid, 3-[ethyl(3-methoxyphenyl)amino]-
CAS:Formula:C12H19NO4SMolecular weight:273.3486
