CymitQuimica logo

CAS 88802-81-7

:

Spiro[5.5]undec-8-ene-1-methanol, 5,5,9-trimethyl-

Description:
Spiro[5.5]undec-8-ene-1-methanol, 5,5,9-trimethyl- is a complex organic compound characterized by its unique spirocyclic structure, which consists of two fused rings sharing a single carbon atom. This compound features a methanol functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of multiple methyl groups enhances its hydrophobicity and influences its physical properties, such as boiling and melting points. The spiro arrangement introduces strain in the molecular structure, which can affect its stability and reactivity. Additionally, the compound may exhibit interesting stereochemical properties due to the presence of chiral centers, making it relevant in the study of stereochemistry and asymmetric synthesis. Its CAS number, 88802-81-7, allows for easy identification in chemical databases. Overall, Spiro[5.5]undec-8-ene-1-methanol, 5,5,9-trimethyl- is of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features and potential functional properties.
Formula:C15H26O
InChI:InChI=1S/C15H26O/c1-12-6-9-15(10-7-12)13(11-16)5-4-8-14(15,2)3/h6,13,16H,4-5,7-11H2,1-3H3
InChI key:NGMQSRDIKSIVIW-UHFFFAOYSA-N
SMILES:CC1=CCC2(CC1)C(CCCC2(C)C)CO
Found 1 products.