CymitQuimica logo

CAS 88805-67-8

:

1H-Indazol-3-amine, 7-chloro-

Description:
1H-Indazol-3-amine, 7-chloro- (CAS 88805-67-8) is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of an amino group (-NH2) at the 3-position and a chlorine atom at the 7-position contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, depending on its specific functional groups. It is often studied for its potential applications in pharmaceuticals, particularly in the development of therapeutic agents due to its structural similarity to other biologically active compounds. The chlorine substituent can influence the compound's electronic properties and steric effects, which may affect its interaction with biological targets. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis.
Formula:C7H6ClN3
InChI:InChI=1S/C7H6ClN3/c8-5-3-1-2-4-6(5)10-11-7(4)9/h1-3H,(H3,9,10,11)
InChI key:HNISSRAYDSNHNN-UHFFFAOYSA-N
SMILES:C1=CC2=C(C(=C1)Cl)NN=C2N
Found 3 products.