CAS 88807-00-5
:2-Thiazolidinone, 4-[(1-ethoxyethoxy)methyl]-, (S)-
Description:
2-Thiazolidinone, 4-[(1-ethoxyethoxy)methyl]-, (S)-, with CAS number 88807-00-5, is a chemical compound characterized by its thiazolidinone core structure, which features a five-membered ring containing both sulfur and nitrogen atoms. This compound exhibits chirality, with the (S)- designation indicating its specific stereochemistry. The presence of the ethoxyethoxy group suggests that it has ether functionalities, which can influence its solubility and reactivity. Thiazolidinones are known for their biological activity, often being explored for potential pharmaceutical applications, including antimicrobial and anti-inflammatory properties. The compound's molecular structure may also contribute to its interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of functional groups can affect its physical properties, such as melting point, boiling point, and solubility in various solvents. Overall, 2-Thiazolidinone, 4-[(1-ethoxyethoxy)methyl]-, (S)- is a compound with potential applications in drug development and a structure that warrants further investigation for its chemical and biological properties.
Formula:C8H15NO3S
InChI:InChI=1S/C8H15NO3S/c1-3-11-6(2)12-4-7-5-13-8(10)9-7/h6-7H,3-5H2,1-2H3,(H,9,10)/t6?,7-/m0/s1
InChI key:ALQXKQVQJNHPJV-MLWJPKLSSA-N
SMILES:CCOC(C)OC[C@H]1CSC(=O)N1
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
