CymitQuimica logo

CAS 88910-22-9

:

2-Furanmethanol, 5-(aminomethyl)-

Description:
2-Furanmethanol, 5-(aminomethyl)-, also known by its CAS number 88910-22-9, is an organic compound characterized by the presence of both a furan ring and an amino group. This compound features a furan moiety, which is a five-membered aromatic ring containing oxygen, and a hydroxymethyl group attached to the furan, along with an aminomethyl substituent. The presence of these functional groups suggests that it may exhibit properties such as solubility in polar solvents and potential reactivity in various chemical reactions, including nucleophilic substitutions and condensation reactions. The amino group can participate in hydrogen bonding, influencing its physical properties and interactions with other molecules. Additionally, compounds like this may have applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis due to their structural features. However, specific data regarding its melting point, boiling point, and other physical properties would require further investigation or reference to specialized chemical databases.
Formula:C6H9NO2
InChI:InChI=1S/C6H9NO2/c7-3-5-1-2-6(4-8)9-5/h1-2,8H,3-4,7H2
InChI key:AMANOVBJYCBOPN-UHFFFAOYSA-N
SMILES:C1=C(OC(=C1)CO)CN
Synonyms:
  • (5-(aminomethyl)furan-2-yl)methanol
  • 2-Furanmethanol, 5-(aminomethyl)-
Found 5 products.