CymitQuimica logo

CAS 890094-31-2

:

1-(5-Amino-2-chloro-6-methyl-4-pyrimidinyl)-4-piperidinecarboxylic acid

Description:
1-(5-Amino-2-chloro-6-methyl-4-pyrimidinyl)-4-piperidinecarboxylic acid, with the CAS number 890094-31-2, is a chemical compound characterized by its complex structure, which includes a pyrimidine ring and a piperidine moiety. This compound features an amino group and a chloro substituent on the pyrimidine ring, contributing to its potential biological activity. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its unique combination of functional groups may also allow for interactions with biological macromolecules, making it a candidate for further research in drug design and development. As with many chemical substances, safety and handling precautions should be observed, and its properties should be evaluated in the context of its intended use.
Formula:C11H15ClN4O2
InChI:InChI=1S/C11H15ClN4O2/c1-6-8(13)9(15-11(12)14-6)16-4-2-7(3-5-16)10(17)18/h7H,2-5,13H2,1H3,(H,17,18)
InChI key:InChIKey=AYZSZZGEUSOKRG-UHFFFAOYSA-N
SMILES:NC=1C(=NC(Cl)=NC1C)N2CCC(C(O)=O)CC2
Synonyms:
  • 4-Piperidinecarboxylic acid, 1-(5-amino-2-chloro-6-methyl-4-pyrimidinyl)-
  • 1-(5-Amino-2-chloro-6-methyl-4-pyrimidinyl)-4-piperidinecarboxylic acid
Found 1 products.