CymitQuimica logo

CAS 890098-91-6

:

[2-(4-methylbenzoyl)phenyl] acetate

Description:
[2-(4-methylbenzoyl)phenyl] acetate, with the CAS number 890098-91-6, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with an acetyl group and a 4-methylbenzoyl moiety, which contributes to its overall stability and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, reflecting its hydrophobic nature due to the presence of multiple aromatic rings. The presence of the acetyl group suggests potential reactivity in acylation reactions, while the aromatic rings may provide UV absorbance properties, making it useful in various applications, including as a potential intermediate in organic synthesis or in materials science. Its molecular structure may also influence its physical properties, such as melting point and boiling point, as well as its behavior in chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C16H14O3
InChI:InChI=1/C16H14O3/c1-11-7-9-13(10-8-11)16(18)14-5-3-4-6-15(14)19-12(2)17/h3-10H,1-2H3
InChI key:QZPNCKDYVPFCRY-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)C(=O)c1ccccc1OC(=O)C
Found 2 products.