CymitQuimica logo

CAS 890707-29-6

:

2-Amino-5-cyano-N,3-dimethylbenzamide

Description:
2-Amino-5-cyano-N,3-dimethylbenzamide is an organic compound characterized by its functional groups and structural features. It contains an amine group (-NH2), a cyano group (-C≡N), and an amide group (-C(=O)N-) attached to a benzene ring that is further substituted with two methyl groups at the N and 3 positions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine and amide functionalities. Its molecular structure suggests potential applications in pharmaceuticals, particularly in drug design, due to the presence of the cyano group, which can participate in various chemical reactions. The compound's reactivity may be influenced by the electron-withdrawing nature of the cyano group and the electron-donating properties of the amino and methyl groups. Additionally, it may exhibit specific biological activities, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C10H11N3O
InChI:InChI=1S/C10H11N3O/c1-6-3-7(5-11)4-8(9(6)12)10(14)13-2/h3-4H,12H2,1-2H3,(H,13,14)
InChI key:InChIKey=UOCPQZOXOQZEGV-UHFFFAOYSA-N
SMILES:C(NC)(=O)C1=CC(C#N)=CC(C)=C1N
Synonyms:
  • Benzamide, 2-amino-5-cyano-N,3-dimethyl-
  • 2-Amino-5-cyano-N-methyl-3-methylbenzamide
  • 2-Amino-5-cyano-N,3-dimethylbenzamide
Found 7 products.