CymitQuimica logo

CAS 89075-43-4

:

1H-Imidazo[4,5-c]pyridine, 2-(2-fluorophenyl)-

Description:
1H-Imidazo[4,5-c]pyridine, 2-(2-fluorophenyl)-, identified by CAS number 89075-43-4, is a heterocyclic organic compound featuring a fused imidazole and pyridine ring system. This compound is characterized by its unique structure, which includes a fluorophenyl substituent at the 2-position of the imidazo ring. The presence of the fluorine atom enhances its electronic properties, potentially influencing its reactivity and interactions with biological targets. Typically, compounds of this class exhibit interesting pharmacological activities, making them of interest in medicinal chemistry. They may possess properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological data would depend on empirical studies. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents. Its synthesis may involve multi-step organic reactions, including cyclization and substitution processes. Overall, 1H-Imidazo[4,5-c]pyridine derivatives are valuable in drug discovery and development due to their diverse biological activities and structural versatility.
Formula:C12H8FN3
InChI:InChI=1S/C12H8FN3/c13-9-4-2-1-3-8(9)12-15-10-5-6-14-7-11(10)16-12/h1-7H,(H,15,16)
InChI key:DFXVIZQVJLSYOJ-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)C2=NC3=C(N2)C=NC=C3)F
Found 4 products.