CymitQuimica logo

CAS 891785-30-1

:

6-Bromo-3-fluoroisoquinoline

Description:
6-Bromo-3-fluoroisoquinoline is a heterocyclic organic compound characterized by the presence of both bromine and fluorine substituents on the isoquinoline ring system. The compound features a bicyclic structure that consists of a fused benzene and pyridine ring, which contributes to its aromatic properties. The bromine atom is located at the 6-position, while the fluorine atom is at the 3-position of the isoquinoline framework. This substitution pattern can influence the compound's reactivity, polarity, and potential biological activity. 6-Bromo-3-fluoroisoquinoline is typically used in medicinal chemistry and material science due to its unique electronic properties and ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Its molecular structure allows for interactions with biological targets, making it of interest in drug discovery. Additionally, the presence of halogens can enhance the compound's stability and solubility in organic solvents, which is advantageous for synthetic applications.
Formula:C9H5BrFN
InChI:InChI=1S/C9H5BrFN/c10-8-2-1-6-5-12-9(11)4-7(6)3-8/h1-5H
InChI key:InChIKey=WOIZAXDBPZEAHP-UHFFFAOYSA-N
SMILES:FC1=CC2=C(C=CC(Br)=C2)C=N1
Synonyms:
  • Isoquinoline, 6-bromo-3-fluoro-
  • 3-Fluoro-6-bromoisoquinoline
  • 6-Bromo-3-fluoroisoquinoline
Found 4 products.