CAS 89240-13-1
:7-Benzofurancarboxaldehyde, 2,3-dihydro-4,5,6-trimethyl-
Description:
7-Benzofurancarboxaldehyde, 2,3-dihydro-4,5,6-trimethyl- is an organic compound characterized by its unique structure, which includes a benzofuran moiety and an aldehyde functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its aromatic properties, contributing to its potential applications in the fragrance and flavor industries. The presence of multiple methyl groups enhances its hydrophobic characteristics, influencing its solubility in organic solvents while limiting its solubility in water. Additionally, the aldehyde functional group can participate in various chemical reactions, such as oxidation and condensation, making it a versatile intermediate in organic synthesis. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, 7-Benzofurancarboxaldehyde, 2,3-dihydro-4,5,6-trimethyl- is a compound of interest in both academic research and industrial applications due to its distinctive chemical properties.
Formula:C12H14O2
InChI:InChI=1S/C12H14O2/c1-7-8(2)10-4-5-14-12(10)11(6-13)9(7)3/h6H,4-5H2,1-3H3
InChI key:PHDJBLKNKWSNQU-UHFFFAOYSA-N
SMILES:CC1=C(C2=C(C(=C1C)C=O)OCC2)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7-Benzofurancarboxaldehyde, 2,3-dihydro-4,5,6-trimethyl-
CAS:Formula:C12H14O2Molecular weight:190.2384
