CymitQuimica logo

CAS 89316-65-4

:

Quinolinium, 1,2,3,4-tetrahydro-1-(3-hydroxypropyl)-1-methyl-, iodide

Description:
Quinolinium, 1,2,3,4-tetrahydro-1-(3-hydroxypropyl)-1-methyl-, iodide, with the CAS number 89316-65-4, is a quaternary ammonium compound characterized by its unique structure that includes a quinolinium ring and a tetrahydro configuration. This compound typically exhibits properties associated with quaternary ammonium salts, such as being a cationic species due to the presence of a positively charged nitrogen atom. It is soluble in polar solvents, which is common for ionic compounds, and may demonstrate biological activity, potentially serving as a precursor or intermediate in pharmaceutical applications. The presence of the hydroxypropyl group suggests potential for hydrogen bonding, influencing its solubility and reactivity. Additionally, the iodide counterion may impart specific properties related to its stability and interaction with other chemical species. Overall, this compound's characteristics make it of interest in various fields, including medicinal chemistry and materials science, where its unique structural features can be leveraged for specific applications.
Formula:C13H20NOI
InChI:InChI=1S/C13H20NO.HI/c1-14(10-5-11-15)9-4-7-12-6-2-3-8-13(12)14;/h2-3,6,8,15H,4-5,7,9-11H2,1H3;1H/q+1;/p-1
InChI key:XACZCGQRBGPDNO-UHFFFAOYSA-M
SMILES:C[N+]1(CCCC2=CC=CC=C21)CCCO.[I-]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.