CymitQuimica logo

CAS 89336-46-9

:

4-Thiazoleacetic acid,2-[[(1,1-dimethylethoxy)carbonyl]amino]-

Description:
4-Thiazoleacetic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]- is a chemical compound characterized by its thiazole ring, which contributes to its heterocyclic nature. The presence of the thiazole moiety imparts unique properties, such as potential biological activity and reactivity. This compound features an acetic acid functional group, which can participate in various chemical reactions, including esterification and amidation. The dimethylethoxycarbonyl group serves as a protective or modifying group, enhancing the compound's stability and solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The compound's CAS number, 89336-46-9, allows for precise identification and cataloging in chemical databases. Overall, 4-Thiazoleacetic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]- is notable for its structural complexity and potential utility in medicinal chemistry and related fields.
Formula:C10H14N2O4S
InChI:InChI=1S/C10H14N2O4S/c1-10(2,3)16-9(15)12-8-11-6(5-17-8)4-7(13)14/h5H,4H2,1-3H3,(H,13,14)(H,11,12,15)
InChI key:LNUBPLFRRHJPLI-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC1=NC(=CS1)CC(=O)O
Synonyms:
  • (2-Tert-Butoxycarbonylamino-Thiazol-4-Yl)-Acetic Acid
  • Boc-2-Amino-4-Thiazole Acetic Acid
Found 6 products.