CAS 89343-06-6

(triisopropylsilyl)acetylene

Description:

Triisopropylsilylacetylene is an organosilicon compound characterized by the presence of a silicon atom bonded to three isopropyl groups and an acetylene functional group. Its molecular structure features a terminal alkyne, which contributes to its reactivity, particularly in coupling reactions and as a building block in organic synthesis. The triisopropylsilyl group enhances the stability and solubility of the compound, making it useful in various synthetic applications. This compound is typically a colorless to pale yellow liquid and is known for its relatively low volatility. It is often employed in the synthesis of more complex organic molecules, including pharmaceuticals and materials science applications. Additionally, due to the presence of the silicon atom, it exhibits unique properties such as increased thermal stability and potential for forming siloxane linkages. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.

Formula: C₁₁H₂₂Si

InChI: InChI=1/C11H22Si/c1-8-12(9(2)3,10(4)5)11(6)7/h1,9-11H,2-7H3

SMILES: C#C[Si](C(C)C)(C(C)C)C(C)C

Synonyms:

• Ethynyltriisopropylsilane
• Ethynyl[Tris(1-Methylethyl)]Silane

Triisopropylsilylacetylene

CAS: 89343-06-6

Formula: C₁₁H₂₂Si

Purity: >95.0%(GC)

Color and Shape: Colorless to Almost colorless clear liquid

Molecular weight: 182.38

Ref: 3B-T1683

Triisopropylsilylacetylene, 97%

CAS: 89343-06-6

Triisopropylsilylacetylene is used as a reagent for the rhodium-catalyzed asymmetric alkylation of alpha, beta-unsaturated carbonyl compounds as well as in the synthesis of beta-alkynylated nitroalkanes. It is utilized in the preparation of bromoethynyl-triisopropyl-silane in the presence of the rea

Formula: C₁₁H₂₂Si

Purity: 97%

Color and Shape: Clear, colourless, Liquid

Molecular weight: 182.38

Ref: 02-H53405

(Triisopropylsilyl)acetylene

CAS: 89343-06-6

Formula: C₁₁H₂₂Si

Purity: 98%

Color and Shape: Liquid

Molecular weight: 182.3779

Ref: IN-DA0034XD

[Tris(isopropyl)silyl]acetylene

CAS: 89343-06-6

[Tris(isopropyl)silyl]acetylene

Formula: C₁₁H₂₂Si

Purity: ≥95%

Color and Shape: clear. colourless liquid

Molecular weight: 182.37788g/mol

Ref: 54-OR30591

(Triisopropylsilyl)acetylene

CAS: 89343-06-6

S18000 - (Triisopropylsilyl)acetylene

Formula: C₁₁H₂₂Si

Purity: 98%

Color and Shape: Clear Liquid

Molecular weight: 182.382

Ref: 10-S18000

Triisopropylsilylacetylene

CAS: 89343-06-6

Triisopropylsilylacetylene is an aliphatic hydrocarbon with a reactive site that can be used in the synthesis of other chemical compounds. It has been shown to have an inhibitory effect on the formation of reactive oxygen species and inflammation in mice, which may be due to its ability to reduce the production of inflammatory mediators such as prostaglandin E2. Triisopropylsilylacetylene also has a hydroxyl group, which allows it to act as an anti-inflammatory agent by inhibiting the enzyme cyclooxygenase. Additionally, triisopropylsilylacetylene has a carbonyl group, which gives it aromatic properties that can be used for synthetic purposes.

Formula: C₁₁H₂₂Si

Purity: Min. 97 Area-%

Color and Shape: Clear Liquid

Molecular weight: 182.38 g/mol

Ref: 3D-FT75801