CymitQuimica logo

CAS 89343-06-6

:

(triisopropylsilyl)acetylene

Description:
Triisopropylsilylacetylene is an organosilicon compound characterized by the presence of a silicon atom bonded to three isopropyl groups and an acetylene functional group. Its molecular structure features a terminal alkyne, which contributes to its reactivity, particularly in coupling reactions and as a building block in organic synthesis. The triisopropylsilyl group enhances the stability and solubility of the compound, making it useful in various synthetic applications. This compound is typically a colorless to pale yellow liquid and is known for its relatively low volatility. It is often employed in the synthesis of more complex organic molecules, including pharmaceuticals and materials science applications. Additionally, due to the presence of the silicon atom, it exhibits unique properties such as increased thermal stability and potential for forming siloxane linkages. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C11H22Si
InChI:InChI=1/C11H22Si/c1-8-12(9(2)3,10(4)5)11(6)7/h1,9-11H,2-7H3
InChI key:KZGWPHUWNWRTEP-UHFFFAOYSA-N
SMILES:C#C[Si](C(C)C)(C(C)C)C(C)C
Synonyms:
  • Ethynyltriisopropylsilane
  • Ethynyl[Tris(1-Methylethyl)]Silane
Found 6 products.