CAS 89343-06-6
:(triisopropylsilyl)acetylene
Description:
Triisopropylsilylacetylene is an organosilicon compound characterized by the presence of a silicon atom bonded to three isopropyl groups and an acetylene functional group. Its molecular structure features a terminal alkyne, which contributes to its reactivity, particularly in coupling reactions and as a building block in organic synthesis. The triisopropylsilyl group enhances the stability and solubility of the compound, making it useful in various synthetic applications. This compound is typically a colorless to pale yellow liquid and is known for its relatively low volatility. It is often employed in the synthesis of more complex organic molecules, including pharmaceuticals and materials science applications. Additionally, due to the presence of the silicon atom, it exhibits unique properties such as increased thermal stability and potential for forming siloxane linkages. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C11H22Si
InChI:InChI=1/C11H22Si/c1-8-12(9(2)3,10(4)5)11(6)7/h1,9-11H,2-7H3
SMILES:C#C[Si](C(C)C)(C(C)C)C(C)C
Synonyms:- Ethynyltriisopropylsilane
- Ethynyl[Tris(1-Methylethyl)]Silane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Triisopropylsilylacetylene
CAS:Formula:C11H22SiPurity:>95.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:182.38Triisopropylsilylacetylene, 97%
CAS:Triisopropylsilylacetylene is used as a reagent for the rhodium-catalyzed asymmetric alkylation of alpha, beta-unsaturated carbonyl compounds as well as in the synthesis of beta-alkynylated nitroalkanes. It is utilized in the preparation of bromoethynyl-triisopropyl-silane in the presence of the reaFormula:C11H22SiPurity:97%Color and Shape:Clear, colourless, LiquidMolecular weight:182.38[Tris(isopropyl)silyl]acetylene
CAS:[Tris(isopropyl)silyl]acetyleneFormula:C11H22SiPurity:≥95%Color and Shape:Liquid-ClearMolecular weight:182.37788(Triisopropylsilyl)acetylene
CAS:Formula:C11H22SiPurity:98%Color and Shape:LiquidMolecular weight:182.3779Ref: IN-DA0034XD
1g24.00€5g24.00€10g28.00€25g53.00€50g61.00€100g100.00€250g179.00€500g237.00€1kg556.00€5kg1,731.00€10kg3,227.00€(Triisopropylsilyl)acetylene
CAS:S18000 - (Triisopropylsilyl)acetylene
Formula:C11H22SiPurity:98%Color and Shape:Clear LiquidMolecular weight:182.382Triisopropylsilylacetylene
CAS:Triisopropylsilylacetylene is an aliphatic hydrocarbon with a reactive site that can be used in the synthesis of other chemical compounds. It has been shown to have an inhibitory effect on the formation of reactive oxygen species and inflammation in mice, which may be due to its ability to reduce the production of inflammatory mediators such as prostaglandin E2. Triisopropylsilylacetylene also has a hydroxyl group, which allows it to act as an anti-inflammatory agent by inhibiting the enzyme cyclooxygenase. Additionally, triisopropylsilylacetylene has a carbonyl group, which gives it aromatic properties that can be used for synthetic purposes.Formula:C11H22SiPurity:Min. 97 Area-%Color and Shape:Clear LiquidMolecular weight:182.38 g/mol





