CymitQuimica logo

CAS 893440-50-1

:

3-Amino-2-methoxypyridine-5-boronic acid pinacol ester

Description:
3-Amino-2-methoxypyridine-5-boronic acid pinacol ester is a boronic acid derivative characterized by the presence of a pyridine ring substituted with an amino group and a methoxy group, along with a boronic acid moiety that is esterified with pinacol. This compound typically exhibits properties associated with both boronic acids and pyridine derivatives, such as the ability to form reversible covalent bonds with diols and other nucleophiles, making it useful in various organic synthesis applications, including cross-coupling reactions. The amino group can participate in hydrogen bonding and may influence the compound's solubility and reactivity. The methoxy group can enhance the electron density of the pyridine ring, potentially affecting its reactivity in electrophilic aromatic substitution reactions. Overall, this compound is of interest in medicinal chemistry and materials science due to its unique structural features and reactivity profile.
Formula:C12H19BN2O3
InChI:InChI=1S/C12H19BN2O3/c1-11(2)12(3,4)18-13(17-11)8-6-9(14)10(16-5)15-7-8/h6-7H,14H2,1-5H3
InChI key:KYYKGOURQXPERA-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)OC)N
Synonyms:
  • 3-Amino-2-methoxypyridin-5-ylboronic acid pinacol ester
  • 2-Methoxy-5-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Pyridin-3-Amine
Found 7 products.