CymitQuimica logo

CAS 89346-51-0

:

1,1'-Biphenyl, 4'-bromo-2,5-dimethyl-

Description:
1,1'-Biphenyl, 4'-bromo-2,5-dimethyl- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a bromine atom at the para position of one phenyl ring and two methyl groups at the 2 and 5 positions of the other ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. It may participate in various chemical reactions, including electrophilic substitution due to the electron-donating effects of the methyl groups and the electron-withdrawing nature of the bromine atom. The compound's structure can influence its reactivity, stability, and potential applications in organic synthesis or as an intermediate in the production of other chemicals. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C14H13Br
InChI:InChI=1S/C14H13Br/c1-10-3-4-11(2)14(9-10)12-5-7-13(15)8-6-12/h3-9H,1-2H3
InChI key:XFAQWVFNDMWZLO-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1)C)C2=CC=C(C=C2)Br
Found 1 products.