CymitQuimica logo

CAS 893613-05-3

:

3-amino-2-[(2-phenylphenyl)amino]benzoic acid

Description:
3-Amino-2-[(2-phenylphenyl)amino]benzoic acid, identified by its CAS number 893613-05-3, is an organic compound characterized by the presence of both amino and carboxylic acid functional groups, which contribute to its acidic properties. This compound features a benzoic acid core substituted with an amino group and a diphenylamino moiety, enhancing its potential for various applications in pharmaceuticals and materials science. The presence of multiple aromatic rings suggests that it may exhibit significant π-π stacking interactions, which can influence its solubility and stability in different solvents. Additionally, the amino groups can participate in hydrogen bonding, affecting its reactivity and interaction with biological targets. The compound's structural complexity may also lead to interesting electronic properties, making it a candidate for studies in organic electronics or as a dye. Overall, its unique combination of functional groups and structural features positions it as a versatile compound in chemical research and development.
Formula:C19H16N2O2
InChI:InChI=1/C19H16N2O2/c20-16-11-6-10-15(19(22)23)18(16)21-17-12-5-4-9-14(17)13-7-2-1-3-8-13/h1-12,21H,20H2,(H,22,23)
InChI key:ITZDTEMQHMKVFN-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1ccccc1Nc1c(cccc1N)C(=O)O
Synonyms:
  • 3-Amino-2-(2-biphenylylamino)benzoic acid
  • 3-Amino-2-(biphenyl-2-ylamino)benzoic acid
  • Benzoic Acid, 3-Amino-2-([1,1'-Biphenyl]-2-Ylamino)-
Found 2 products.