CAS 89438-35-7
:2-Furanamine, N,3-dimethyl-5-[(4-methylphenyl)sulfinyl]-N-phenyl-
Description:
2-Furanamine, N,3-dimethyl-5-[(4-methylphenyl)sulfinyl]-N-phenyl- is an organic compound characterized by its furanamine structure, which includes a furan ring and amine functional groups. The presence of the dimethyl and phenyl groups contributes to its unique chemical properties, including potential solubility in organic solvents and varying reactivity due to the electron-donating and electron-withdrawing effects of these substituents. The sulfinyl group attached to the aromatic ring may enhance the compound's reactivity, making it of interest in various chemical reactions, including nucleophilic substitutions. This compound may exhibit biological activity, which could be explored in pharmaceutical applications. Its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, this compound represents a complex structure with diverse applications in organic synthesis and medicinal chemistry.
Formula:C19H19NO2S
InChI:InChI=1S/C19H19NO2S/c1-14-9-11-17(12-10-14)23(21)18-13-15(2)19(22-18)20(3)16-7-5-4-6-8-16/h4-13H,1-3H3
InChI key:FYLXZDXHYYGHSH-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)S(=O)C2=CC(=C(O2)N(C)C3=CC=CC=C3)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Furanamine, N,3-dimethyl-5-[(4-methylphenyl)sulfinyl]-N-phenyl-
CAS:Formula:C19H19NO2SMolecular weight:325.4247
