CAS 89440-58-4
:1H-1,2,4-Triazole, 1-[1-[(4-ethoxyphenyl)thio]-2-methyl-2-phenylpropyl]-
Description:
1H-1,2,4-Triazole, 1-[1-[(4-ethoxyphenyl)thio]-2-methyl-2-phenylpropyl]- is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a complex side chain that includes a thioether linkage with a 4-ethoxyphenyl group, contributing to its potential biological activity. The presence of the ethoxy group enhances its solubility and may influence its interaction with biological targets. The compound's structure suggests potential applications in pharmaceuticals, particularly in antifungal or herbicidal activities, as triazoles are known for their role in inhibiting specific enzymes in fungi. Additionally, the presence of multiple aromatic rings may contribute to its stability and lipophilicity, affecting its pharmacokinetic properties. As with many triazole derivatives, the compound's reactivity and interactions can be influenced by the substituents on the aromatic rings and the overall steric and electronic environment. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.
Formula:C20H23N3OS
InChI:InChI=1S/C20H23N3OS/c1-4-24-17-10-12-18(13-11-17)25-19(23-15-21-14-22-23)20(2,3)16-8-6-5-7-9-16/h5-15,19H,4H2,1-3H3
InChI key:IQYUVNZCNPQLAY-UHFFFAOYSA-N
SMILES:CCOC1=CC=C(C=C1)SC(C(C)(C)C2=CC=CC=C2)N3C=NC=N3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-1,2,4-Triazole, 1-[1-[(4-ethoxyphenyl)thio]-2-methyl-2-phenylpropyl]-
CAS:Formula:C20H23N3OSMolecular weight:353.4811
