CAS 89481-79-8

Thieno[3,2-c]pyridin-2(4H)-one,5-[(2-chlorophenyl)methyl]-5,6,7,7a-tetrahydro-, ethanedioate (1:1)

Description:

Thieno[3,2-c]pyridin-2(4H)-one, 5-[(2-chlorophenyl)methyl]-5,6,7,7a-tetrahydro-, ethanedioate (1:1), with CAS number 89481-79-8, is a chemical compound characterized by its complex bicyclic structure that incorporates both thieno and pyridine moieties. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, which contributes to its potential biological activity. The presence of a 2-chlorophenyl group suggests that it may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. The ethanedioate component indicates that the compound may form salts or complexes, which can affect its solubility and stability. Overall, this compound's unique structural features may render it of interest in medicinal chemistry, particularly in the development of novel therapeutic agents. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential applications.

Formula: C₁₄H₁₄ClNOSC₂H₂O₄

InChI: InChI=1S/C14H14ClNOS.C2H2O4/c15-12-4-2-1-3-10(12)8-16-6-5-13-11(9-16)7-14(17)18-13;3-1(4)2(5)6/h1-4,7,13H,5-6,8-9H2;(H,3,4)(H,5,6)

InChI key: XCSCKPYHWFJINT-UHFFFAOYSA-N

SMILES: C1CN(CC2=CC(=O)SC21)CC3=CC=CC=C3Cl.C(=O)(C(=O)O)O

5-(2-Chlorobenzyl)-5,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2(4H)-one oxalate

CAS: 89481-79-8

5-(2-Chlorobenzyl)-5,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2(4H)-one oxalate

Purity: 98%

Ref: 54-OR1076475