CymitQuimica logo

CAS 89536-85-6

:

Boc-N-Me-D-Val-OH

Description:
Boc-N-Me-D-Val-OH, also known as N-Boc-N-methyl-D-valine, is a protected amino acid commonly used in peptide synthesis. The "Boc" (tert-butyloxycarbonyl) group serves as a protective group for the amino functionality, allowing for selective reactions without interfering with the amine. This compound features a D-valine structure, which is one of the two enantiomers of valine, an essential branched-chain amino acid. The presence of the methyl group on the nitrogen atom enhances its steric properties and can influence the overall reactivity and solubility of the molecule. Boc-N-Me-D-Val-OH is typically a white to off-white solid and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but less soluble in water. Its applications extend to the synthesis of peptides and other bioactive compounds, making it valuable in pharmaceutical research and development. Proper handling and storage are essential due to its potential reactivity, particularly in the presence of strong acids or bases.
Formula:C11H21NO4
InChI:InChI=1S/C11H21NO4/c1-7(2)8(9(13)14)12(6)10(15)16-11(3,4)5/h7-8H,1-6H3,(H,13,14)/t8-/m1/s1
InChI key:XPUAXAVJMJDPDH-MRVPVSSYSA-N
SMILES:CC(C)[C@H](C(=O)O)N(C)C(=O)OC(C)(C)C
Synonyms:
  • Boc-D-MeVal-OH
  • Boc-N-methyl-D-valine
Found 6 products.