CymitQuimica logo

CAS 89593-15-7

:

Cyclohexadienylium, 3,3′-(1,2-ethenediyl)bis[1,5,6,6-tetramethyl-

Description:
Cyclohexadienylium, 3,3′-(1,2-ethenediyl)bis[1,5,6,6-tetramethyl-] is a complex organic compound characterized by its unique structure, which features a cyclohexadienylium cation and a bis(1,2-ethenediyl) linkage. This compound is notable for its stability and reactivity due to the presence of multiple double bonds and the cationic nature of the cyclohexadienylium moiety. The tetramethyl substituents enhance its steric bulk, influencing its chemical behavior and interactions. Typically, such compounds exhibit interesting electronic properties, making them potential candidates for applications in organic electronics or as intermediates in synthetic chemistry. The presence of the cationic center suggests that it may participate in electrophilic reactions, while the conjugated system could allow for resonance stabilization. Overall, the compound's unique structural features contribute to its potential utility in various chemical applications, although specific reactivity and stability would depend on the surrounding conditions and environment.
Formula:C22H30
InChI:InChI=1S/C22H30/c1-15-11-19(12-16(2)21(15,5)6)9-10-20-13-17(3)22(7,8)18(4)14-20/h9-14H,1-8H3/q+2
InChI key:JIDRNLYHXFHRSV-UHFFFAOYSA-N
SMILES:CC1=CC(=C[C+](C1(C)C)C)C=CC2=C[C+](C(C(=C2)C)(C)C)C
Synonyms:
  • Cyclohexadienylium, 3,3′-(1,2-ethenediyl)bis[1,5,6,6-tetramethyl-
Found 1 products.