CAS 89607-81-8
:Acetamide, 2,2,2-trichloro-N-(2-thienylsulfonyl)-
Description:
Acetamide, 2,2,2-trichloro-N-(2-thienylsulfonyl)-, also known by its CAS number 89607-81-8, is an organic compound characterized by the presence of a thienylsulfonyl group and multiple chlorine substituents on the acetamide structure. This compound typically exhibits a white to off-white solid appearance and is soluble in polar solvents due to the presence of the sulfonamide functional group. The trichloro substituents enhance its reactivity, making it useful in various chemical syntheses and applications, particularly in the field of agrochemicals and pharmaceuticals. Its thienyl moiety contributes to its biological activity, potentially influencing its interaction with biological targets. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, this compound represents a unique combination of functional groups that can be leveraged for specific chemical reactions and applications in research and industry.
Formula:C6H4Cl3NO3S2
InChI:InChI=1S/C6H4Cl3NO3S2/c7-6(8,9)5(11)10-15(12,13)4-2-1-3-14-4/h1-3H,(H,10,11)
InChI key:QWRCAFZXDWXGKC-UHFFFAOYSA-N
SMILES:C1=CSC(=C1)S(=O)(=O)NC(=O)C(Cl)(Cl)Cl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
