CymitQuimica logo

CAS 89610-90-2

:

2,5-Cyclohexadiene-1-carboxylic acid, 4-bicyclo[2.2.1]hept-2-yl-

Description:
2,5-Cyclohexadiene-1-carboxylic acid, 4-bicyclo[2.2.1]hept-2-yl- is an organic compound characterized by its bicyclic structure and the presence of both a carboxylic acid and a cyclohexadiene moiety. The compound features a bicyclo[2.2.1]heptane framework, which contributes to its unique three-dimensional shape and potential reactivity. The cyclohexadiene portion indicates the presence of two double bonds, which can participate in various chemical reactions, such as electrophilic addition or polymerization. The carboxylic acid functional group (-COOH) imparts acidic properties, allowing the compound to engage in acid-base reactions and potentially form salts or esters. This compound may exhibit interesting physical properties, such as solubility in organic solvents and varying melting and boiling points depending on the specific conditions. Its structural features suggest potential applications in organic synthesis, pharmaceuticals, or as intermediates in chemical reactions. However, specific reactivity and stability would depend on the surrounding conditions and the presence of other functional groups.
Formula:C14H18O2
InChI:InChI=1S/C14H18O2/c15-14(16)11-5-3-10(4-6-11)13-8-9-1-2-12(13)7-9/h3-6,9-13H,1-2,7-8H2,(H,15,16)
InChI key:WRGCPZAKZNHVKT-UHFFFAOYSA-N
SMILES:C1CC2CC1CC2C3C=CC(C=C3)C(=O)O
Found 1 products.