CymitQuimica logo

CAS 89677-46-3

:

(2,4-dibromo-5-methoxy-phenyl)boronic acid

Description:
(2,4-Dibromo-5-methoxy-phenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with two bromine atoms and a methoxy group. This compound typically exhibits properties such as moderate solubility in polar organic solvents and water, depending on the pH due to the boronic acid group, which can exist in both neutral and anionic forms. The presence of bromine atoms enhances its reactivity, making it useful in cross-coupling reactions, particularly in Suzuki-Miyaura reactions for the formation of carbon-carbon bonds. The methoxy group can influence the electronic properties of the molecule, potentially enhancing its reactivity and solubility. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in various applications, including sensor technology and drug delivery systems. Overall, (2,4-dibromo-5-methoxy-phenyl)boronic acid is a versatile compound with significant utility in organic synthesis and materials science.
Formula:C7H7BBr2O3
InChI:InChI=1/C7H7BBr2O3/c1-13-7-2-4(8(11)12)5(9)3-6(7)10/h2-3,11-12H,1H3
InChI key:GOAYGALQWXVCFY-UHFFFAOYSA-N
SMILES:COc1cc(c(cc1Br)Br)B(O)O
Found 3 products.