CAS 89683-17-0
:1H-Naphtho[2,3-d]triazole-4,9-dione, 6,7-dimethyl-5-(methylsulfonyl)-
Description:
1H-Naphtho[2,3-d]triazole-4,9-dione, 6,7-dimethyl-5-(methylsulfonyl)-, with the CAS number 89683-17-0, is a synthetic organic compound characterized by its complex structure, which includes a naphthalene core fused with a triazole ring and multiple functional groups. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents due to its hydrophobic naphthalene structure and polar methylsulfonyl group. The presence of the triazole moiety may impart biological activity, making it of interest in pharmaceutical research. Its chemical stability is influenced by the electron-withdrawing nature of the dione and sulfonyl groups, which can affect reactivity and interactions with other molecules. Additionally, the methyl substituents on the naphthalene ring can influence its physical properties, such as melting point and solubility. Overall, this compound's unique structure and functional groups suggest potential applications in various fields, including medicinal chemistry and materials science.
Formula:C13H11N3O4S
InChI:InChI=1S/C13H11N3O4S/c1-5-4-7-8(13(6(5)2)21(3,19)20)12(18)10-9(11(7)17)14-16-15-10/h4H,1-3H3,(H,14,15,16)
InChI key:QMAJMHXKIWUYAZ-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C(=C1C)S(=O)(=O)C)C(=O)C3=NNN=C3C2=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Naphtho[2,3-d]triazole-4,9-dione, 6,7-dimethyl-5-(methylsulfonyl)-
CAS:Formula:C13H11N3O4SMolecular weight:305.3091
