CAS 89687-52-5
:Distannoxane, 1,1,3,3-tetrakis(4-chlorophenyl)-1,3-dicyclohexyl-
Description:
Distannoxane, 1,1,3,3-tetrakis(4-chlorophenyl)-1,3-dicyclohexyl- (CAS 89687-52-5) is an organotin compound characterized by its unique structure, which includes two dicyclohexyl groups and four 4-chlorophenyl substituents attached to a central tin-oxygen framework. This compound typically exhibits properties associated with organotin compounds, such as potential applications in polymer stabilization and as a catalyst in various chemical reactions. Its chlorophenyl groups may impart specific electronic and steric effects, influencing its reactivity and solubility in organic solvents. The presence of multiple tin atoms suggests potential for coordination chemistry and interactions with various ligands. Additionally, due to the presence of chlorine atoms, the compound may exhibit distinct environmental and toxicological profiles, necessitating careful handling and assessment of its safety in industrial applications. Overall, distannoxane represents a specialized class of organotin compounds with diverse potential applications in materials science and organic synthesis.
Formula:C36H38Cl4OSn2
InChI:InChI=1S/4C6H4Cl.2C6H11.O.2Sn/c4*7-6-4-2-1-3-5-6;2*1-2-4-6-5-3-1;;;/h4*2-5H;2*1H,2-6H2;;;
InChI key:NOXMXBKWNRIMHT-UHFFFAOYSA-N
SMILES:C1CCC(CC1)[Sn](C2=CC=C(C=C2)Cl)(C3=CC=C(C=C3)Cl)O[Sn](C4CCCCC4)(C5=CC=C(C=C5)Cl)C6=CC=C(C=C6)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Distannoxane, 1,1,3,3-tetrakis(4-chlorophenyl)-1,3-dicyclohexyl-
CAS:Formula:C36H38Cl4OSn2Molecular weight:865.9003
