CymitQuimica logo

CAS 89694-45-1

:

5-Bromo-2-methoxyphenylboronic acid

Description:
5-Bromo-2-methoxyphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a bromine atom and a methoxy group attached to a phenyl ring, contributing to its unique reactivity and solubility properties. It is typically a white to off-white solid and is soluble in polar organic solvents. The presence of the boronic acid group makes it useful in various applications, particularly in Suzuki-Miyaura cross-coupling reactions, which are essential in organic synthesis for forming carbon-carbon bonds. Additionally, the bromine substituent can serve as a leaving group in further chemical transformations. This compound is also of interest in medicinal chemistry and materials science due to its potential in drug development and the synthesis of functionalized materials. As with many organoboron compounds, it should be handled with care, following appropriate safety protocols due to its reactivity and potential environmental impact.
Formula:C7H8BBrO3
InChI:InChI=1S/C7H8BBrO3/c1-12-7-3-2-5(9)4-6(7)8(10)11/h2-4,10-11H,1H3
InChI key:InChIKey=FVRLSHRAYPFXRQ-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(OC)C=CC(Br)=C1
Synonyms:
  • 3-Bromo-6-methoxyphenylboronic acid
  • 5-Bromo-2-Methoxyphenylboronic Acid
  • 5-Bromo-2-methoxybenzeneboronic acid
  • B-(5-Bromo-2-methoxyphenyl)boronic acid
  • Benzeneboronic acid, 5-bromo-2-methoxy-
  • Boronic acid, (5-bromo-2-methoxyphenyl)-
  • boronic acid, B-(5-bromo-2-methoxyphenyl)-
Found 5 products.