CymitQuimica logo

CAS 897031-95-7

:

L-Lysine, L-prolyl-L-isoleucyl-L-arginyl-L-phenylalanyl-L-threonyl-

Description:
The chemical substance known as "L-Lysine, L-prolyl-L-isoleucyl-L-arginyl-L-phenylalanyl-L-threonyl-" is a peptide composed of multiple amino acids, specifically L-lysine, L-proline, L-isoleucine, L-arginine, L-phenylalanine, and L-threonine. This compound is characterized by its sequence of amino acids, which contributes to its structural and functional properties. Peptides like this one are typically involved in various biological processes, including signaling, metabolism, and cellular functions. The presence of different amino acids imparts unique characteristics, such as hydrophilicity or hydrophobicity, which can influence the peptide's solubility and interaction with other biomolecules. The CAS number 897031-95-7 uniquely identifies this specific peptide, facilitating its recognition in scientific literature and databases. Such compounds are often studied for their potential therapeutic applications, including their roles in nutrition, biochemistry, and pharmacology. Overall, the characteristics of this peptide are determined by its amino acid composition and sequence, which dictate its biological activity and potential uses.
Formula:C36H60N10O8
InChI:InChI=1S/C36H60N10O8/c1-4-21(2)28(45-30(48)24-15-10-18-40-24)33(51)42-25(16-11-19-41-36(38)39)31(49)44-27(20-23-12-6-5-7-13-23)32(50)46-29(22(3)47)34(52)43-26(35(53)54)14-8-9-17-37/h5-7,12-13,21-22,24-29,40,47H,4,8-11,14-20,37H2,1-3H3,(H,42,51)(H,43,52)(H,44,49)(H,45,48)(H,46,50)(H,53,54)(H4,38,39,41)/t21-,22+,24-,25-,26-,27-,28-,29-/m0/s1
InChI key:MFFSKRFRVBINKP-HHRCTJKHSA-N
SMILES:CC[C@H](C)[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)[C@@H]2CCCN2
Found 1 products.