CAS 89711-08-0
:tert-butyl N-(2-oxoethyl)carbamate
Description:
Tert-butyl N-(2-oxoethyl)carbamate is an organic compound characterized by its carbamate functional group, which is derived from the reaction of an amine with a carbonic acid derivative. This compound features a tert-butyl group, providing steric hindrance and influencing its reactivity and solubility. The presence of the 2-oxoethyl moiety suggests that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Typically, compounds like this are utilized in organic synthesis, particularly in the formation of more complex molecules or as intermediates in pharmaceutical development. Its properties, such as solubility in organic solvents and stability under certain conditions, make it a valuable building block in synthetic chemistry. Additionally, the compound's structure may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C7H13NO3
InChI:InChI=1/C7H13NO3/c1-7(2,3)11-6(10)8-4-5-9/h5H,4H2,1-3H3,(H,8,10)
InChI key:ACNRTYKOPZDRCO-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=NCC=O)O
Synonyms:- Tert-Butyl (2-Oxoethyl)Carbamate
- N-Boc-2-aminoacetaldehyde
- Carbamic acid, N-(2-oxoethyl)-, 1,1-dimethylethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
tert-Butyl (2-Oxoethyl)carbamate
CAS:Formula:C7H13NO3Purity:>98.0%(GC)Color and Shape:White or Colorless to Light yellow powder to lump to clear liquidMolecular weight:159.19N-Boc-2-aminoacetaldehyde
CAS:N-Boc-2-aminoacetaldehydeFormula:C7H13NO3Purity:95%Color and Shape:SolidMolecular weight:159.18302N-Boc-2-Aminoacetaldehyde
CAS:Formula:C7H13NO3Purity:95Color and Shape:LiquidMolecular weight:159.185N-Boc-2-aminoacetaldehyde (Technical Grade)
CAS:Controlled ProductFormula:C7H13NO3Color and Shape:NeatMolecular weight:159.18N-Boc-2-aminoacetaldehyde
CAS:N-Boc-2-aminoacetaldehydeFormula:C7H13NO3Purity:95% GCMolecular weight:159.18N-Boc-2-aminoacetaldehyde
CAS:N-Boc-2-aminoacetaldehyde is an aliphatic aldehyde that has been used in the synthesis of a number of bioactive molecules. It is synthesized by reacting an N-Boc amino acid with chloroform and hydrochloric acid. The reaction time is typically 2 hours at room temperature, although it can be decreased to 20 minutes if the temperature is increased to 60°C. The product can be purified using extraction or recrystallization methods. N-Boc-2-aminoacetaldehyde reacts with chloride ions to form phosphoranes, which are useful in clinical development as antimicrobial peptides. This compound also reacts with fluorine to form hydrogenated derivatives that have been shown to have neurokinin activity in animal models.
Formula:C7H13NO3Purity:Min. 95%Color and Shape:Colorless PowderMolecular weight:159.18 g/mol







