CymitQuimica logo

CAS 89782-62-7

:

Benzenesulfonamide, N-(5-amino-1,3,4-thiadiazol-2-yl)-

Description:
Benzenesulfonamide, N-(5-amino-1,3,4-thiadiazol-2-yl)-, is a chemical compound characterized by its sulfonamide functional group attached to a benzene ring and a thiadiazole moiety. This compound features a five-membered heterocyclic ring containing both nitrogen and sulfur atoms, which contributes to its unique chemical properties. The presence of the amino group enhances its potential for biological activity, making it of interest in medicinal chemistry. Benzenesulfonamides are known for their antibacterial properties, and the specific structure of this compound may influence its pharmacological profile. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. The compound's reactivity can be attributed to the sulfonamide group, which can participate in various chemical reactions, including nucleophilic substitutions. Additionally, the thiadiazole ring can engage in interactions with biological targets, potentially leading to therapeutic applications. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, highlighting the importance of structural features in determining chemical behavior and biological activity.
Formula:C8H8N4O2S2
InChI:InChI=1S/C8H8N4O2S2/c9-7-10-11-8(15-7)12-16(13,14)6-4-2-1-3-5-6/h1-5H,(H2,9,10)(H,11,12)
InChI key:KHVQWBZRCVLKSL-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)S(=O)(=O)NC2=NN=C(S2)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.