CymitQuimica logo

CAS 898280-07-4

:

XL228

Description:
XL228, with the CAS number 898280-07-4, is a small molecule that functions primarily as a kinase inhibitor. It has been investigated for its potential therapeutic applications, particularly in the treatment of various cancers. The compound selectively targets specific kinases involved in cellular signaling pathways that regulate cell growth and survival, making it a candidate for cancer therapy. XL228 exhibits a unique chemical structure that contributes to its biological activity, although detailed structural information is typically proprietary. In preclinical studies, it has shown promise in inhibiting tumor growth and overcoming resistance to other therapies. As with many investigational drugs, the safety and efficacy of XL228 are evaluated through clinical trials, and its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion, are critical for understanding its potential as a therapeutic agent. Further research is necessary to fully elucidate its mechanism of action and to establish optimal dosing regimens for clinical use.
Formula:C22H31N9O
InChI:InChI=1S/C22H31N9O/c1-14(2)17-10-16(32-29-17)13-23-22-25-19(24-20-11-18(27-28-20)15-4-5-15)12-21(26-22)31-8-6-30(3)7-9-31/h10-12,14-15H,4-9,13H2,1-3H3,(H3,23,24,25,26,27,28)
InChI key:ALKJNCZNEOTEMP-UHFFFAOYSA-N
SMILES:CC(C)C1=NOC(=C1)CNC2=NC(=CC(=N2)N3CCN(CC3)C)NC4=NNC(=C4)C5CC5
Found 5 products.