CymitQuimica logo

CAS 898289-58-2

:

4-(Hexahydro-4-methyl-1H-1,4-diazepin-1-yl)benzenemethanol

Description:
4-(Hexahydro-4-methyl-1H-1,4-diazepin-1-yl)benzenemethanol, identified by its CAS number 898289-58-2, is a chemical compound characterized by its unique structure that includes a hexahydro-1,4-diazepine moiety and a benzyl alcohol functional group. This compound typically exhibits properties associated with both amines and alcohols, which may influence its solubility in various solvents, often showing moderate solubility in polar organic solvents. The presence of the diazepine ring suggests potential biological activity, as such structures are often found in pharmacologically active compounds. Additionally, the compound may participate in hydrogen bonding due to the hydroxyl group, affecting its reactivity and interactions with other molecules. Its molecular structure may also confer specific stereochemical properties, which can be significant in biological systems. Overall, while detailed physical and chemical properties such as melting point, boiling point, and specific reactivity would require empirical data, the compound's functional groups suggest a range of potential applications in medicinal chemistry and material science.
Formula:C13H20N2O
InChI:InChI=1/C13H20N2O/c1-14-7-2-8-15(10-9-14)13-5-3-12(11-16)4-6-13/h3-6,16H,2,7-11H2,1H3
InChI key:InChIKey=DZPOSPVFLJMLQF-UHFFFAOYSA-N
SMILES:C(O)C1=CC=C(C=C1)N2CCCN(C)CC2
Synonyms:
  • [4-(4-Methyl-1,4-diazepan-1-yl)phenyl]methanol
  • 4-(Hexahydro-4-methyl-1H-1,4-diazepin-1-yl)benzenemethanol
  • [4-(4-Methylperhydro-1,4-diazepin-1-yl)phenyl]methanol
  • Benzenemethanol, 4-(hexahydro-4-methyl-1H-1,4-diazepin-1-yl)-
Found 1 products.