CymitQuimica logo

CAS 898746-50-4

:

5-Iodo-1H-pyrrolo[2,3-b]pyridine

Description:
5-Iodo-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, with an iodine substituent at the 5-position of the pyrrole ring. This compound typically exhibits a molecular structure that contributes to its unique chemical properties, including potential reactivity due to the presence of the iodine atom, which can participate in various substitution reactions. The compound is often studied for its biological activity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its heterocyclic nature allows for interactions with biological targets, making it of interest in drug discovery. Additionally, the presence of the iodine atom may enhance lipophilicity and influence the compound's pharmacokinetic properties. As with many heterocycles, 5-Iodo-1H-pyrrolo[2,3-b]pyridine may exhibit interesting electronic properties, which can be explored in various chemical reactions and applications in materials science. Safety and handling precautions should be observed due to the potential hazards associated with iodine-containing compounds.
Formula:C7H5IN2
InChI:InChI=1S/C7H5IN2/c8-6-3-5-1-2-9-7(5)10-4-6/h1-4H,(H,9,10)
InChI key:InChIKey=CYMDPTJBUBTWEY-UHFFFAOYSA-N
SMILES:IC=1C=C2C(=NC1)NC=C2
Synonyms:
  • 1H-pyrrolo[2,3-b]pyridine, 5-iodo-
  • 5-Iod-1H-pyrrolo[2,3-b]pyridin
  • 5-Iodo-7-azaindole
  • 5-Iodo-1H-pyrrolo[2,3-b]pyridine
Found 4 products.