CymitQuimica logo

CAS 898753-72-5

:

1-Propanone, 1-(3-chloro-4-fluorophenyl)-3-(2,5-dimethylphenyl)-

Description:
1-Propanone, 1-(3-chloro-4-fluorophenyl)-3-(2,5-dimethylphenyl)-, also known by its CAS number 898753-72-5, is an organic compound characterized by its ketone functional group, which features a carbonyl group (C=O) bonded to two hydrocarbon groups. This compound exhibits a complex structure due to the presence of a chloro and a fluoro substituent on the aromatic ring, contributing to its unique chemical properties. The presence of the dimethylphenyl group further enhances its hydrophobic characteristics. Typically, compounds of this nature are used in various applications, including pharmaceuticals and agrochemicals, due to their potential biological activity. The molecular structure suggests that it may exhibit interesting reactivity patterns, particularly in electrophilic aromatic substitution reactions. Additionally, the presence of halogen atoms can influence the compound's polarity and solubility in different solvents. Overall, this compound represents a class of substituted ketones that may have significant implications in synthetic organic chemistry and material science.
Formula:C17H16ClFO
InChI:InChI=1S/C17H16ClFO/c1-11-3-4-12(2)13(9-11)6-8-17(20)14-5-7-16(19)15(18)10-14/h3-5,7,9-10H,6,8H2,1-2H3
InChI key:InChIKey=MCYPVZSDNUPQDR-UHFFFAOYSA-N
SMILES:C(CCC1=C(C)C=CC(C)=C1)(=O)C2=CC(Cl)=C(F)C=C2
Synonyms:
  • 3′-Chloro-3-(2,5-dimethylphenyl)-4′-fluoropropiophenone
  • 1-Propanone, 1-(3-chloro-4-fluorophenyl)-3-(2,5-dimethylphenyl)-
  • 1-(3-Chloro-4-fluorophenyl)-3-(2,5-dimethylphenyl)-1-propanone
Found 1 products.