CymitQuimica logo

CAS 898759-94-9

:

3-[4-(1,3-dioxolan-2-yl)benzoyl]benzonitrile

Description:
3-[4-(1,3-Dioxolan-2-yl)benzoyl]benzonitrile, with the CAS number 898759-94-9, is an organic compound characterized by its complex structure, which includes a dioxolane ring and a nitrile functional group. The presence of the dioxolane moiety suggests that it may exhibit properties such as increased solubility in polar solvents and potential reactivity in various chemical transformations. The benzoyl and benzonitrile groups contribute to its aromatic character, which can influence its electronic properties and stability. This compound may be of interest in pharmaceutical or materials science applications due to its potential biological activity and ability to participate in further chemical reactions. Additionally, the presence of multiple functional groups can lead to interesting interactions in biological systems or in synthetic pathways. Overall, the unique combination of functional groups in this compound suggests a versatile chemical behavior, making it a candidate for further research and application in various fields.
Formula:C17H13NO3
InChI:InChI=1/C17H13NO3/c18-11-12-2-1-3-15(10-12)16(19)13-4-6-14(7-5-13)17-20-8-9-21-17/h1-7,10,17H,8-9H2
SMILES:c1cc(cc(c1)C(=O)c1ccc(cc1)C1OCCO1)C#N
Synonyms:
  • 3-CYANO-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
  • 3-[4-(1,3-dioxolan-2-yl)benzoyl]benzonitrile
Found 1 products.