CymitQuimica logo

CAS 898760-23-1

:

(4-butoxyphenyl)-oxazol-2-yl-methanone

Description:
(4-butoxyphenyl)-oxazol-2-yl-methanone, identified by its CAS number 898760-23-1, is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing nitrogen and oxygen. This compound features a butoxy group attached to a phenyl ring, contributing to its hydrophobic characteristics and potentially influencing its solubility and reactivity. The methanone functional group indicates the presence of a carbonyl group (C=O) adjacent to the oxazole, which can participate in various chemical reactions, such as nucleophilic attacks. The overall structure suggests potential applications in pharmaceuticals or materials science, particularly in the development of compounds with specific biological activities or as intermediates in organic synthesis. Its unique combination of functional groups may also impart interesting optical or electronic properties, making it a candidate for research in fields such as organic electronics or photochemistry. As with any chemical substance, safety data and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C14H15NO3
InChI:InChI=1/C14H15NO3/c1-2-3-9-17-12-6-4-11(5-7-12)13(16)14-15-8-10-18-14/h4-8,10H,2-3,9H2,1H3
InChI key:DCBDQIREDMOEDJ-UHFFFAOYSA-N
SMILES:CCCCOc1ccc(cc1)C(=O)c1ncco1
Found 4 products.