CymitQuimica logo

CAS 898762-15-7

:

Methanone, [2-[(4-methyl-1-piperazinyl)methyl]phenyl][4-(trifluoromethyl)phenyl]-

Description:
Methanone, specifically the compound known as [2-[(4-methyl-1-piperazinyl)methyl]phenyl][4-(trifluoromethyl)phenyl]- (CAS 898762-15-7), is a synthetic organic compound characterized by its complex structure that includes a piperazine moiety and multiple aromatic rings. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the trifluoromethyl group enhances lipophilicity and may influence the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. The piperazine ring is often associated with various pharmacological effects, including anxiolytic and antidepressant activities. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used, making it essential to consider these factors in practical applications. Overall, this compound represents a class of substances that may have significant implications in pharmaceutical research and development.
Formula:C20H21F3N2O
InChI:InChI=1S/C20H21F3N2O/c1-24-10-12-25(13-11-24)14-16-4-2-3-5-18(16)19(26)15-6-8-17(9-7-15)20(21,22)23/h2-9H,10-14H2,1H3
InChI key:InChIKey=VVPDYJONODNUES-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(CN2CCN(C)CC2)C=CC=C1)C3=CC=C(C(F)(F)F)C=C3
Synonyms:
  • 2-(4-Methylpiperazinomethyl)-4′-trifluoromethylbenzophenone
  • Methanone, [2-[(4-methyl-1-piperazinyl)methyl]phenyl][4-(trifluoromethyl)phenyl]-
  • [2-[(4-Methyl-1-piperazinyl)methyl]phenyl][4-(trifluoromethyl)phenyl]methanone
Found 1 products.