CymitQuimica logo

CAS 898763-22-9

:

(3,4-dimethylphenyl)-[3-(thiomorpholinomethyl)phenyl]methanone

Description:
(3,4-Dimethylphenyl)-[3-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898763-22-9, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and a thiomorpholine moiety. This compound features a phenyl ring substituted with two methyl groups at the 3 and 4 positions, enhancing its lipophilicity and potentially influencing its biological activity. The presence of the thiomorpholinomethyl group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure may contribute to its solubility and reactivity, which are critical for its application in various chemical and pharmaceutical contexts. Additionally, the presence of multiple functional groups indicates that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Overall, this compound's unique structural features may provide insights into its potential uses in drug development and other chemical applications.
Formula:C20H23NOS
InChI:InChI=1/C20H23NOS/c1-15-6-7-19(12-16(15)2)20(22)18-5-3-4-17(13-18)14-21-8-10-23-11-9-21/h3-7,12-13H,8-11,14H2,1-2H3
InChI key:BAKUOJWYTJGWTD-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1C)C(=O)c1cccc(c1)CN1CCSCC1
Found 1 products.