CymitQuimica logo

CAS 898767-35-6

:

1-(2-fluorophenyl)-3-(3-fluorophenyl)propan-1-one

Description:
1-(2-Fluorophenyl)-3-(3-fluorophenyl)propan-1-one, identified by its CAS number 898767-35-6, is an organic compound characterized by its ketone functional group and the presence of fluorine substituents on the phenyl rings. This compound features a propanone backbone, where the carbonyl group is flanked by two aromatic rings, each containing a fluorine atom at specific positions. The presence of fluorine enhances the compound's lipophilicity and may influence its reactivity and biological activity. Typically, such compounds are of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in organic synthesis. The molecular structure suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, including nucleophilic additions and electrophilic substitutions. Additionally, the fluorine atoms can affect the compound's stability and solubility in different solvents, making it a subject of study in both theoretical and applied chemistry contexts.
Formula:C15H12F2O
InChI:InChI=1/C15H12F2O/c16-12-5-3-4-11(10-12)8-9-15(18)13-6-1-2-7-14(13)17/h1-7,10H,8-9H2
InChI key:InChIKey=LPXUJNNYNAITBS-UHFFFAOYSA-N
SMILES:C(CCC1=CC(F)=CC=C1)(=O)C2=C(F)C=CC=C2
Synonyms:
  • 2′-Fluoro-3-(3-fluorophenyl)propiophenone
  • 1-(2-Fluorophenyl)-3-(3-fluorophenyl)-1-propanone
  • 1-Propanone, 1-(2-fluorophenyl)-3-(3-fluorophenyl)-
Found 1 products.