CymitQuimica logo

CAS 898788-16-4

:

8-[3,5-bis(trifluoromethyl)phenyl]-8-oxo-octanoic acid

Description:
8-[3,5-bis(trifluoromethyl)phenyl]-8-oxo-octanoic acid is a synthetic organic compound characterized by its unique structure, which includes an octanoic acid backbone with a ketone functional group and a phenyl ring substituted with two trifluoromethyl groups. This compound is likely to exhibit significant lipophilicity due to the long hydrocarbon chain and the presence of the trifluoromethyl groups, which can enhance its biological activity and stability. The trifluoromethyl groups are known for their electron-withdrawing properties, which can influence the compound's reactivity and interaction with biological targets. Additionally, the presence of the ketone functional group may contribute to its potential as a reactive intermediate in various chemical reactions. Given its structural features, this compound may be of interest in pharmaceutical research, particularly in the development of novel therapeutic agents. However, specific biological activities, toxicity, and environmental impact would require further investigation through empirical studies.
Formula:C16H16F6O3
InChI:InChI=1/C16H16F6O3/c17-15(18,19)11-7-10(8-12(9-11)16(20,21)22)13(23)5-3-1-2-4-6-14(24)25/h7-9H,1-6H2,(H,24,25)
InChI key:DRZIJDGACZQXLN-UHFFFAOYSA-N
SMILES:C(CCCC(=O)O)CCC(=O)c1cc(cc(c1)C(F)(F)F)C(F)(F)F
Found 1 products.