CymitQuimica logo

CAS 898788-27-7

:

1-Propanone, 3-(4-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]-

Description:
1-Propanone, 3-(4-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is indicated by the "propanone" part of its name. This compound features a propanone backbone with two distinct aromatic substituents: a 4-chlorophenyl group and a 3-(trifluoromethyl)phenyl group. The presence of the chlorine and trifluoromethyl groups introduces significant electronegative characteristics, which can influence the compound's reactivity and polarity. Typically, such compounds exhibit moderate to high lipophilicity due to their aromatic nature, which can affect their solubility in various solvents. The trifluoromethyl group is known for imparting unique electronic properties, often enhancing the compound's biological activity. Additionally, the presence of halogens can affect the compound's stability and reactivity in chemical reactions. Overall, this compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications and unique structural features.
Formula:C16H12ClF3O
InChI:InChI=1S/C16H12ClF3O/c17-14-7-4-11(5-8-14)6-9-15(21)12-2-1-3-13(10-12)16(18,19)20/h1-5,7-8,10H,6,9H2
InChI key:InChIKey=OPFPOMNAPGTRMD-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(Cl)C=C1)(=O)C2=CC(C(F)(F)F)=CC=C2
Synonyms:
  • 1-Propanone, 3-(4-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]-
  • 3-(4-Chlorophenyl)-1-[3-(trifluoromethyl)phenyl]-1-propanone
Found 1 products.