CymitQuimica logo

CAS 898790-56-2

:

cyclobutyl-(2-methylsulfanylphenyl)methanone

Description:
Cyclobutyl-(2-methylsulfanylphenyl)methanone is an organic compound characterized by its unique structure, which includes a cyclobutyl group and a phenyl ring substituted with a methylthio group. This compound typically exhibits properties common to ketones, such as being a polar molecule due to the carbonyl functional group, which can engage in hydrogen bonding with solvents. The presence of the cyclobutyl ring contributes to its rigidity and may influence its reactivity and stability. The methylthio group can enhance the compound's lipophilicity, potentially affecting its solubility in organic solvents. Additionally, the compound may exhibit interesting biological activities, making it of interest in medicinal chemistry. Its synthesis and reactivity can be influenced by the steric and electronic effects of the substituents on the phenyl ring. Overall, cyclobutyl-(2-methylsulfanylphenyl)methanone represents a complex structure that may have diverse applications in chemical research and development.
Formula:C12H14OS
InChI:InChI=1/C12H14OS/c1-14-11-8-3-2-7-10(11)12(13)9-5-4-6-9/h2-3,7-9H,4-6H2,1H3
InChI key:BVKMQDIJXIQUFH-UHFFFAOYSA-N
SMILES:CSc1ccccc1C(=O)C1CCC1
Found 1 products.